C23H26F3N7S — CID 126533981
5-[3-[(4-methyl-5-pyrazin-2-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole (PubChem CID 126533981) has the molecular formula C23H26F3N7S and a molecular weight of 489.57 g/mol. Its IUPAC name is 5-[3-[(4-methyl-5-pyrazin-2-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole.
| Compound Name | 5-[3-[(4-methyl-5-pyrazin-2-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 126533981 |
| Molecular Formula | C23H26F3N7S |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 5-[3-[(4-methyl-5-pyrazin-2-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
| SMILES | Cn1c(SCCCN2CC3CCN(c4ccc(C(F)(F)F)cc4)C3C2)nnc1-c1cnccn1 |
| InChI | InChI=1S/C23H26F3N7S/c1-31-21(19-13-27-8-9-28-19)29-30-22(31)34-12-2-10-32-14-16-7-11-33(20(16)15-32)18-5-3-17(4-6-18)23(24,25)26/h3-6,8-9,13,16,20H,2,7,10-12,14-15H2,1H3 |
| InChIKey | IYZBRQAAJGEDNI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|