C25H34F3N5O — CID 126535084
(3aS,6aS)-5-[4-[4-methyl-5-(oxan-4-yl)-1,2,4-triazol-3-yl]butyl]-1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole (PubChem CID 126535084) has the molecular formula C25H34F3N5O and a molecular weight of 477.58 g/mol. Its IUPAC name is (3aS,6aS)-5-[4-[4-methyl-5-(oxan-4-yl)-1,2,4-triazol-3-yl]butyl]-1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole.
| Compound Name | (3aS,6aS)-5-[4-[4-methyl-5-(oxan-4-yl)-1,2,4-triazol-3-yl]butyl]-1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 126535084 |
| Molecular Formula | C25H34F3N5O |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | (3aS,6aS)-5-[4-[4-methyl-5-(oxan-4-yl)-1,2,4-triazol-3-yl]butyl]-1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
| SMILES | Cn1c(CCCCN2C[C@@H]3CCN(c4ccc(C(F)(F)F)cc4)[C@@H]3C2)nnc1C1CCOCC1 |
| InChI | InChI=1S/C25H34F3N5O/c1-31-23(29-30-24(31)18-10-14-34-15-11-18)4-2-3-12-32-16-19-9-13-33(22(19)17-32)21-7-5-20(6-8-21)25(26,27)28/h5-8,18-19,22H,2-4,9-17H2,1H3/t19-,22+/m0/s1 |
| InChIKey | IRDGCSMAHBCDAT-SIKLNZKXSA-N |
| XLogP | 4.26 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|