C24H32F3N5S — CID 126534116
(3aS,6aS)-5-[3-[(5-cyclopentyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]-1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole (PubChem CID 126534116) has the molecular formula C24H32F3N5S and a molecular weight of 479.62 g/mol. Its IUPAC name is (3aS,6aS)-5-[3-[(5-cyclopentyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]-1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole.
| Compound Name | (3aS,6aS)-5-[3-[(5-cyclopentyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]-1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 126534116 |
| Molecular Formula | C24H32F3N5S |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | (3aS,6aS)-5-[3-[(5-cyclopentyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]-1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
| SMILES | Cn1c(SCCCN2C[C@@H]3CCN(c4ccc(C(F)(F)F)cc4)[C@@H]3C2)nnc1C1CCCC1 |
| InChI | InChI=1S/C24H32F3N5S/c1-30-22(17-5-2-3-6-17)28-29-23(30)33-14-4-12-31-15-18-11-13-32(21(18)16-31)20-9-7-19(8-10-20)24(25,26)27/h7-10,17-18,21H,2-6,11-16H2,1H3/t18-,21+/m0/s1 |
| InChIKey | IONCAKHVNMAPQA-GHTZIAJQSA-N |
| XLogP | 5.18 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|