C24H27F3N6OS — CID 126534204
4-[4-methyl-5-[3-[1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-1,2,4-triazol-3-yl]-1H-pyridin-2-one (PubChem CID 126534204) has the molecular formula C24H27F3N6OS and a molecular weight of 504.58 g/mol. Its IUPAC name is 4-[4-methyl-5-[3-[1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-1,2,4-triazol-3-yl]-1H-pyridin-2-one.
| Compound Name | 4-[4-methyl-5-[3-[1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-1,2,4-triazol-3-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 126534204 |
| Molecular Formula | C24H27F3N6OS |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 4-[4-methyl-5-[3-[1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-1,2,4-triazol-3-yl]-1H-pyridin-2-one |
| SMILES | Cn1c(SCCCN2CC3CCN(c4ccc(C(F)(F)F)cc4)C3C2)nnc1-c1cc[nH]c(=O)c1 |
| InChI | InChI=1S/C24H27F3N6OS/c1-31-22(16-7-9-28-21(34)13-16)29-30-23(31)35-12-2-10-32-14-17-8-11-33(20(17)15-32)19-5-3-18(4-6-19)24(25,26)27/h3-7,9,13,17,20H,2,8,10-12,14-15H2,1H3,(H,28,34) |
| InChIKey | CRAJXQNFXAOYDL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 70.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|