C25H29F3N6OS — CID 126535075
1-methyl-5-[4-methyl-5-[3-[1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-1,2,4-triazol-3-yl]pyridin-2-one (PubChem CID 126535075) has the molecular formula C25H29F3N6OS and a molecular weight of 518.61 g/mol. Its IUPAC name is 1-methyl-5-[4-methyl-5-[3-[1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-1,2,4-triazol-3-yl]pyridin-2-one.
| Compound Name | 1-methyl-5-[4-methyl-5-[3-[1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-1,2,4-triazol-3-yl]pyridin-2-one |
|---|---|
| PubChem CID | 126535075 |
| Molecular Formula | C25H29F3N6OS |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 1-methyl-5-[4-methyl-5-[3-[1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-1,2,4-triazol-3-yl]pyridin-2-one |
| SMILES | Cn1c(SCCCN2CC3CCN(c4ccc(C(F)(F)F)cc4)C3C2)nnc1-c1ccc(=O)n(C)c1 |
| InChI | InChI=1S/C25H29F3N6OS/c1-31-14-18(4-9-22(31)35)23-29-30-24(32(23)2)36-13-3-11-33-15-17-10-12-34(21(17)16-33)20-7-5-19(6-8-20)25(26,27)28/h4-9,14,17,21H,3,10-13,15-16H2,1-2H3 |
| InChIKey | STIWHEMFVTWALB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 59.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|