C24H35N7O — CID 126537468
N-[1-(1H-indol-3-yl)hexan-2-yl]-3-[(3R,5R)-3,4,5-trimethylpiperazin-1-yl]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 126537468) has the molecular formula C24H35N7O and a molecular weight of 437.59 g/mol. Its IUPAC name is N-[1-(1H-indol-3-yl)hexan-2-yl]-3-[(3R,5R)-3,4,5-trimethylpiperazin-1-yl]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-[1-(1H-indol-3-yl)hexan-2-yl]-3-[(3R,5R)-3,4,5-trimethylpiperazin-1-yl]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 126537468 |
| Molecular Formula | C24H35N7O |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.29 |
| IUPAC Name | N-[1-(1H-indol-3-yl)hexan-2-yl]-3-[(3R,5R)-3,4,5-trimethylpiperazin-1-yl]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CCCCC(Cc1c[nH]c2ccccc12)NC(=O)c1nc(N2C[C@@H](C)N(C)[C@H](C)C2)n[nH]1 |
| InChI | InChI=1S/C24H35N7O/c1-5-6-9-19(12-18-13-25-21-11-8-7-10-20(18)21)26-23(32)22-27-24(29-28-22)31-14-16(2)30(4)17(3)15-31/h7-8,10-11,13,16-17,19,25H,5-6,9,12,14-15H2,1-4H3,(H,26,32)(H,27,28,29)/t16-,17-,19?/m1/s1 |
| InChIKey | IYKXWPUHGXUQIC-QNZPCDNOSA-N |
| XLogP | 3.35 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |