C24H29N7OS — CID 135262698
N-[1-(1H-indol-3-yl)hexan-2-yl]-2-(3-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-1,3-thiazole-5-carboxamide (PubChem CID 135262698) has the molecular formula C24H29N7OS and a molecular weight of 463.61 g/mol. Its IUPAC name is N-[1-(1H-indol-3-yl)hexan-2-yl]-2-(3-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-[1-(1H-indol-3-yl)hexan-2-yl]-2-(3-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 135262698 |
| Molecular Formula | C24H29N7OS |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | N-[1-(1H-indol-3-yl)hexan-2-yl]-2-(3-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-1,3-thiazole-5-carboxamide |
| SMILES | CCCCC(Cc1c[nH]c2ccccc12)NC(=O)c1cnc(N2CCn3c(C)nnc3C2)s1 |
| InChI | InChI=1S/C24H29N7OS/c1-3-4-7-18(12-17-13-25-20-9-6-5-8-19(17)20)27-23(32)21-14-26-24(33-21)30-10-11-31-16(2)28-29-22(31)15-30/h5-6,8-9,13-14,18,25H,3-4,7,10-12,15H2,1-2H3,(H,27,32) |
| InChIKey | IOUSCQRKRWMGPL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |