C24H33N7OS — CID 72948452
N-[1-amino-1-butylimino-3-(1H-indol-3-yl)propan-2-yl]-2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxamide (PubChem CID 72948452) has the molecular formula C24H33N7OS and a molecular weight of 467.64 g/mol. Its IUPAC name is N-[1-amino-1-butylimino-3-(1H-indol-3-yl)propan-2-yl]-2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-[1-amino-1-butylimino-3-(1H-indol-3-yl)propan-2-yl]-2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 72948452 |
| Molecular Formula | C24H33N7OS |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | N-[1-amino-1-butylimino-3-(1H-indol-3-yl)propan-2-yl]-2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxamide |
| SMILES | CCCC/N=C(\N)C(Cc1c[nH]c2ccccc12)NC(=O)c1cnc(N2CCN(C)CC2)s1 |
| InChI | InChI=1S/C24H33N7OS/c1-3-4-9-26-22(25)20(14-17-15-27-19-8-6-5-7-18(17)19)29-23(32)21-16-28-24(33-21)31-12-10-30(2)11-13-31/h5-8,15-16,20,27H,3-4,9-14H2,1-2H3,(H2,25,26)(H,29,32) |
| InChIKey | CHMZLKPEOCRMNU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 102.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|