C23H31N7OS — CID 142405211
2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-N-[1-(1H-indol-3-yl)hexan-2-yl]-1,3-thiazole-5-carboxamide;molecular hydrogen (PubChem CID 142405211) has the molecular formula C23H31N7OS and a molecular weight of 453.62 g/mol. Its IUPAC name is 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-N-[1-(1H-indol-3-yl)hexan-2-yl]-1,3-thiazole-5-carboxamide;molecular hydrogen.
| Compound Name | 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-N-[1-(1H-indol-3-yl)hexan-2-yl]-1,3-thiazole-5-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 142405211 |
| Molecular Formula | C23H31N7OS |
| Molecular Weight | 453.62 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-N-[1-(1H-indol-3-yl)hexan-2-yl]-1,3-thiazole-5-carboxamide;molecular hydrogen |
| SMILES | CCCCC(Cc1c[nH]c2ccccc12)NC(=O)c1cnc(N2CCn3cnnc3C2)s1.[H][H].[H][H] |
| InChI | InChI=1S/C23H27N7OS.2H2/c1-2-3-6-17(11-16-12-24-19-8-5-4-7-18(16)19)27-22(31)20-13-25-23(32-20)29-9-10-30-15-26-28-21(30)14-29;;/h4-5,7-8,12-13,15,17,24H,2-3,6,9-11,14H2,1H3,(H,27,31);2*1H |
| InChIKey | VVPAXACXFPSJNQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.62 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |