C17H37N3 — CID 126537911
5-N,5-N-dimethyl-6-N-(2-methylheptan-3-yl)hept-6-ene-1,5,6-triamine (PubChem CID 126537911) has the molecular formula C17H37N3 and a molecular weight of 283.50 g/mol. Its IUPAC name is 5-N,5-N-dimethyl-6-N-(2-methylheptan-3-yl)hept-6-ene-1,5,6-triamine.
| Compound Name | 5-N,5-N-dimethyl-6-N-(2-methylheptan-3-yl)hept-6-ene-1,5,6-triamine |
|---|---|
| PubChem CID | 126537911 |
| Molecular Formula | C17H37N3 |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.30 |
| IUPAC Name | 5-N,5-N-dimethyl-6-N-(2-methylheptan-3-yl)hept-6-ene-1,5,6-triamine |
| SMILES | C=C(NC(CCCC)C(C)C)C(CCCCN)N(C)C |
| InChI | InChI=1S/C17H37N3/c1-7-8-11-16(14(2)3)19-15(4)17(20(5)6)12-9-10-13-18/h14,16-17,19H,4,7-13,18H2,1-3,5-6H3 |
| InChIKey | MLBKSVBRWWMYRT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|