C19H36F3N5 — CID 174259071
2-N,5-dimethyl-1-N-[2-[3-(methylamino)prop-1-en-2-ylamino]but-3-enyl]-1-N-(2,2,2-trifluoroethyl)hept-6-ene-1,2,6-triamine (PubChem CID 174259071) has the molecular formula C19H36F3N5 and a molecular weight of 391.53 g/mol. Its IUPAC name is 2-N,5-dimethyl-1-N-[2-[3-(methylamino)prop-1-en-2-ylamino]but-3-enyl]-1-N-(2,2,2-trifluoroethyl)hept-6-ene-1,2,6-triamine.
| Compound Name | 2-N,5-dimethyl-1-N-[2-[3-(methylamino)prop-1-en-2-ylamino]but-3-enyl]-1-N-(2,2,2-trifluoroethyl)hept-6-ene-1,2,6-triamine |
|---|---|
| PubChem CID | 174259071 |
| Molecular Formula | C19H36F3N5 |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.29 |
| IUPAC Name | 2-N,5-dimethyl-1-N-[2-[3-(methylamino)prop-1-en-2-ylamino]but-3-enyl]-1-N-(2,2,2-trifluoroethyl)hept-6-ene-1,2,6-triamine |
| SMILES | C=CC(CN(CC(CCC(C)C(=C)N)NC)CC(F)(F)F)NC(=C)CNC |
| InChI | InChI=1S/C19H36F3N5/c1-7-17(26-15(3)10-24-5)11-27(13-19(20,21)22)12-18(25-6)9-8-14(2)16(4)23/h7,14,17-18,24-26H,1,3-4,8-13,23H2,2,5-6H3 |
| InChIKey | ADXHSCYBELKKAA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 65.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|