C41H71N5 — CID 167238964
1-N-hexa-1,5-dien-2-yl-6-N-[5-[[7-(hexa-1,5-dien-2-ylamino)-3-methylhept-1-en-2-yl]amino]hept-6-enyl]-5-N-(5-methylhexa-1,5-dien-2-yl)hept-6-ene-1,5,6-triamine (PubChem CID 167238964) has the molecular formula C41H71N5 and a molecular weight of 634.05 g/mol. Its IUPAC name is 1-N-hexa-1,5-dien-2-yl-6-N-[5-[[7-(hexa-1,5-dien-2-ylamino)-3-methylhept-1-en-2-yl]amino]hept-6-enyl]-5-N-(5-methylhexa-1,5-dien-2-yl)hept-6-ene-1,5,6-triamine.
| Compound Name | 1-N-hexa-1,5-dien-2-yl-6-N-[5-[[7-(hexa-1,5-dien-2-ylamino)-3-methylhept-1-en-2-yl]amino]hept-6-enyl]-5-N-(5-methylhexa-1,5-dien-2-yl)hept-6-ene-1,5,6-triamine |
|---|---|
| PubChem CID | 167238964 |
| Molecular Formula | C41H71N5 |
| Molecular Weight | 634.05 g/mol |
| Exact Mass | 633.57 |
| IUPAC Name | 1-N-hexa-1,5-dien-2-yl-6-N-[5-[[7-(hexa-1,5-dien-2-ylamino)-3-methylhept-1-en-2-yl]amino]hept-6-enyl]-5-N-(5-methylhexa-1,5-dien-2-yl)hept-6-ene-1,5,6-triamine |
| SMILES | C=CCCC(=C)NCCCCC(C)C(=C)NC(C=C)CCCCNC(=C)C(CCCCNC(=C)CCC=C)NC(=C)CCC(=C)C |
| InChI | InChI=1S/C41H71N5/c1-12-15-24-35(7)42-30-20-17-23-34(6)38(10)46-40(14-3)26-18-21-32-44-39(11)41(45-37(9)29-28-33(4)5)27-19-22-31-43-36(8)25-16-13-2/h12-14,34,40-46H,1-4,7-11,15-32H2,5-6H3 |
| InChIKey | IQCYLVAQKURZLE-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.05 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|