C24H38N2 — CID 126735538
(Z)-4-ethyl-2-N-[1-[6-ethyl-4-[(3E)-penta-1,3-dien-3-yl]cyclohexa-1,5-dien-1-yl]ethenyl]hept-5-ene-1,2-diamine (PubChem CID 126735538) has the molecular formula C24H38N2 and a molecular weight of 354.58 g/mol. Its IUPAC name is (Z)-4-ethyl-2-N-[1-[6-ethyl-4-[(3E)-penta-1,3-dien-3-yl]cyclohexa-1,5-dien-1-yl]ethenyl]hept-5-ene-1,2-diamine.
| Compound Name | (Z)-4-ethyl-2-N-[1-[6-ethyl-4-[(3E)-penta-1,3-dien-3-yl]cyclohexa-1,5-dien-1-yl]ethenyl]hept-5-ene-1,2-diamine |
|---|---|
| PubChem CID | 126735538 |
| Molecular Formula | C24H38N2 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.30 |
| IUPAC Name | (Z)-4-ethyl-2-N-[1-[6-ethyl-4-[(3E)-penta-1,3-dien-3-yl]cyclohexa-1,5-dien-1-yl]ethenyl]hept-5-ene-1,2-diamine |
| SMILES | C=C/C(=C\C)C1C=C(CC)C(C(=C)NC(CN)CC(/C=C\C)CC)=CC1 |
| InChI | InChI=1S/C24H38N2/c1-7-12-19(8-2)15-23(17-25)26-18(6)24-14-13-22(16-21(24)11-5)20(9-3)10-4/h7,9-10,12,14,16,19,22-23,26H,3,6,8,11,13,15,17,25H2,1-2,4-5H3/b12-7-,20-10+ |
| InChIKey | PNHBHNWJXVEEGS-YHCUMPAJSA-N |
| XLogP | 5.82 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|