C23H41F6N5 — CID 129044700
1-[6-(1,3-diamino-4,4,4-trifluorobutyl)-4-(3-ethylheptyl)-1,2-dihydropyridin-2-yl]-4,4,4-trifluoro-1-N-methylbutane-1,3-diamine (PubChem CID 129044700) has the molecular formula C23H41F6N5 and a molecular weight of 501.60 g/mol. Its IUPAC name is 1-[6-(1,3-diamino-4,4,4-trifluorobutyl)-4-(3-ethylheptyl)-1,2-dihydropyridin-2-yl]-4,4,4-trifluoro-1-N-methylbutane-1,3-diamine.
| Compound Name | 1-[6-(1,3-diamino-4,4,4-trifluorobutyl)-4-(3-ethylheptyl)-1,2-dihydropyridin-2-yl]-4,4,4-trifluoro-1-N-methylbutane-1,3-diamine |
|---|---|
| PubChem CID | 129044700 |
| Molecular Formula | C23H41F6N5 |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.33 |
| IUPAC Name | 1-[6-(1,3-diamino-4,4,4-trifluorobutyl)-4-(3-ethylheptyl)-1,2-dihydropyridin-2-yl]-4,4,4-trifluoro-1-N-methylbutane-1,3-diamine |
| SMILES | CCCCC(CC)CCC1=CC(C(CC(N)C(F)(F)F)NC)NC(C(N)CC(N)C(F)(F)F)=C1 |
| InChI | InChI=1S/C23H41F6N5/c1-4-6-7-14(5-2)8-9-15-10-17(16(30)12-20(31)22(24,25)26)34-19(11-15)18(33-3)13-21(32)23(27,28)29/h10-11,14,16,18-21,33-34H,4-9,12-13,30-32H2,1-3H3 |
| InChIKey | ZFLARBATINCZKP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |