C56H50N5O2S+ — CID 126539583
[5-[bis[4-(N-ethyl-2,6-dimethylanilino)phenyl]methylidene]-3-cyano-4-phenylthiophen-2-ylidene]-(2-nitrophenyl)-phenylazanium (PubChem CID 126539583) has the molecular formula C56H50N5O2S+ and a molecular weight of 857.12 g/mol. Its IUPAC name is [5-[bis[4-(N-ethyl-2,6-dimethylanilino)phenyl]methylidene]-3-cyano-4-phenylthiophen-2-ylidene]-(2-nitrophenyl)-phenylazanium.
| Compound Name | [5-[bis[4-(N-ethyl-2,6-dimethylanilino)phenyl]methylidene]-3-cyano-4-phenylthiophen-2-ylidene]-(2-nitrophenyl)-phenylazanium |
|---|---|
| PubChem CID | 126539583 |
| Molecular Formula | C56H50N5O2S+ |
| Molecular Weight | 857.12 g/mol |
| Exact Mass | 856.37 |
| IUPAC Name | [5-[bis[4-(N-ethyl-2,6-dimethylanilino)phenyl]methylidene]-3-cyano-4-phenylthiophen-2-ylidene]-(2-nitrophenyl)-phenylazanium |
| SMILES | CCN(c1ccc(C(=C2S/C(=[N+](/c3ccccc3)c3ccccc3[N+](=O)[O-])C(C#N)=C2c2ccccc2)c2ccc(N(CC)c3c(C)cccc3C)cc2)cc1)c1c(C)cccc1C |
| InChI | InChI=1S/C56H50N5O2S/c1-7-58(53-38(3)19-17-20-39(53)4)45-33-29-43(30-34-45)51(44-31-35-46(36-32-44)59(8-2)54-40(5)21-18-22-41(54)6)55-52(42-23-11-9-12-24-42)48(37-57)56(64-55)60(47-25-13-10-14-26-47)49-27-15-16-28-50(49)61(62)63/h9-36H,7-8H2,1-6H3/q+1 |
| InChIKey | XKKGXSKJXYQZHB-UHFFFAOYSA-N |
| XLogP | 14.56 |
| TPSA | 76.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.12 |
| LogP ≤ 5 | 14.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|