C6H5IN2 — CID 126539981
2-iodo-5-methyl-1,3-diazacyclohepta-2,4,6,7-tetraene (PubChem CID 126539981) has the molecular formula C6H5IN2 and a molecular weight of 232.02 g/mol. Its IUPAC name is 2-iodo-5-methyl-1,3-diazacyclohepta-2,4,6,7-tetraene.
| Compound Name | 2-iodo-5-methyl-1,3-diazacyclohepta-2,4,6,7-tetraene |
|---|---|
| PubChem CID | 126539981 |
| Molecular Formula | C6H5IN2 |
| Molecular Weight | 232.02 g/mol |
| Exact Mass | 231.95 |
| IUPAC Name | 2-iodo-5-methyl-1,3-diazacyclohepta-2,4,6,7-tetraene |
| SMILES | CC1=CN=C(I)N=C=C1 |
| InChI | InChI=1S/C6H5IN2/c1-5-2-3-8-6(7)9-4-5/h2,4H,1H3 |
| InChIKey | FDIDGLGLWMSDSA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.02 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|