C6H5IN2 — CID 126582304
4-iodo-6-methyl-1,3-diazacyclohepta-1,2,4,6-tetraene (PubChem CID 126582304) has the molecular formula C6H5IN2 and a molecular weight of 232.02 g/mol. Its IUPAC name is 4-iodo-6-methyl-1,3-diazacyclohepta-1,2,4,6-tetraene.
| Compound Name | 4-iodo-6-methyl-1,3-diazacyclohepta-1,2,4,6-tetraene |
|---|---|
| PubChem CID | 126582304 |
| Molecular Formula | C6H5IN2 |
| Molecular Weight | 232.02 g/mol |
| Exact Mass | 231.95 |
| IUPAC Name | 4-iodo-6-methyl-1,3-diazacyclohepta-1,2,4,6-tetraene |
| SMILES | CC1=CN=C=NC(I)=C1 |
| InChI | InChI=1S/C6H5IN2/c1-5-2-6(7)9-4-8-3-5/h2-3H,1H3 |
| InChIKey | HSXCUYMHAQKEHZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.02 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|