C33H41FN2O2 — CID 126541052
N-[(3S)-3-fluoropentyl]-N-[(1S,2R,5S,6R,14R,16R)-5-isoquinolin-7-yl-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-yl]hydroxylamine (PubChem CID 126541052) has the molecular formula C33H41FN2O2 and a molecular weight of 516.70 g/mol. Its IUPAC name is N-[(3S)-3-fluoropentyl]-N-[(1S,2R,5S,6R,14R,16R)-5-isoquinolin-7-yl-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-yl]hydroxylamine.
| Compound Name | N-[(3S)-3-fluoropentyl]-N-[(1S,2R,5S,6R,14R,16R)-5-isoquinolin-7-yl-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-yl]hydroxylamine |
|---|---|
| PubChem CID | 126541052 |
| Molecular Formula | C33H41FN2O2 |
| Molecular Weight | 516.70 g/mol |
| Exact Mass | 516.32 |
| IUPAC Name | N-[(3S)-3-fluoropentyl]-N-[(1S,2R,5S,6R,14R,16R)-5-isoquinolin-7-yl-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-yl]hydroxylamine |
| SMILES | CC[C@H](F)CCN(O)[C@@H]1CCC2=CC3=CC[C@]4(C)[C@@H](c5ccc6ccncc6c5)CC[C@H]4[C@@]34CC[C@]2(C1)O4 |
| InChI | InChI=1S/C33H41FN2O2/c1-3-27(34)12-17-36(37)28-7-6-25-19-26-10-13-31(2)29(23-5-4-22-11-16-35-21-24(22)18-23)8-9-30(31)33(26)15-14-32(25,20-28)38-33/h4-5,10-11,16,18-19,21,27-30,37H,3,6-9,12-15,17,20H2,1-2H3/t27-,28+,29+,30+,31+,32+,33+/m0/s1 |
| InChIKey | BHKOXWBJOVZAEX-LWBMJDBZSA-N |
| XLogP | 7.67 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.70 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|