C15H28N4O — CID 126541883
(1R,4Z,8S,9R)-5-[amino(2,2-dimethylpropyl)amino]-9-(nitrosomethyl)bicyclo[6.1.0]non-4-en-4-amine (PubChem CID 126541883) has the molecular formula C15H28N4O and a molecular weight of 280.42 g/mol. Its IUPAC name is (1R,4Z,8S,9R)-5-[amino(2,2-dimethylpropyl)amino]-9-(nitrosomethyl)bicyclo[6.1.0]non-4-en-4-amine.
| Compound Name | (1R,4Z,8S,9R)-5-[amino(2,2-dimethylpropyl)amino]-9-(nitrosomethyl)bicyclo[6.1.0]non-4-en-4-amine |
|---|---|
| PubChem CID | 126541883 |
| Molecular Formula | C15H28N4O |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | (1R,4Z,8S,9R)-5-[amino(2,2-dimethylpropyl)amino]-9-(nitrosomethyl)bicyclo[6.1.0]non-4-en-4-amine |
| SMILES | CC(C)(C)CN(N)/C1=C(\N)CC[C@@H]2[C@H](CC1)[C@@H]2CN=O |
| InChI | InChI=1S/C15H28N4O/c1-15(2,3)9-19(17)14-7-5-11-10(4-6-13(14)16)12(11)8-18-20/h10-12H,4-9,16-17H2,1-3H3/b14-13-/t10-,11+,12-/m1/s1 |
| InChIKey | IIEMCRDLJUUOSC-GPPBQUTDSA-N |
| XLogP | 2.58 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|