C15H31N3 — CID 145240224
(1S,4Z,8R)-5-[amino(2-methylpropyl)amino]bicyclo[6.1.0]non-4-en-4-amine;ethane (PubChem CID 145240224) has the molecular formula C15H31N3 and a molecular weight of 253.43 g/mol. Its IUPAC name is (1S,4Z,8R)-5-[amino(2-methylpropyl)amino]bicyclo[6.1.0]non-4-en-4-amine;ethane.
| Compound Name | (1S,4Z,8R)-5-[amino(2-methylpropyl)amino]bicyclo[6.1.0]non-4-en-4-amine;ethane |
|---|---|
| PubChem CID | 145240224 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | (1S,4Z,8R)-5-[amino(2-methylpropyl)amino]bicyclo[6.1.0]non-4-en-4-amine;ethane |
| SMILES | CC.CC(C)CN(N)/C1=C(\N)CC[C@H]2C[C@H]2CC1 |
| InChI | InChI=1S/C13H25N3.C2H6/c1-9(2)8-16(15)13-6-4-11-7-10(11)3-5-12(13)14;1-2/h9-11H,3-8,14-15H2,1-2H3;1-2H3/b13-12-;/t10-,11+;/m0./s1 |
| InChIKey | FWIWKRBPPGBIML-CSWWTAAYSA-N |
| XLogP | 3.22 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|