C16H31N3 — CID 142474587
(4Z)-5-[amino(methyl)amino]bicyclo[6.1.0]non-4-en-4-amine;3-methylidenepentane (PubChem CID 142474587) has the molecular formula C16H31N3 and a molecular weight of 265.44 g/mol. Its IUPAC name is (4Z)-5-[amino(methyl)amino]bicyclo[6.1.0]non-4-en-4-amine;3-methylidenepentane.
| Compound Name | (4Z)-5-[amino(methyl)amino]bicyclo[6.1.0]non-4-en-4-amine;3-methylidenepentane |
|---|---|
| PubChem CID | 142474587 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | (4Z)-5-[amino(methyl)amino]bicyclo[6.1.0]non-4-en-4-amine;3-methylidenepentane |
| SMILES | C=C(CC)CC.CN(N)/C1=C(\N)CCC2CC2CC1 |
| InChI | InChI=1S/C10H19N3.C6H12/c1-13(12)10-5-3-8-6-7(8)2-4-9(10)11;1-4-6(3)5-2/h7-8H,2-6,11-12H2,1H3;3-5H2,1-2H3/b10-9-; |
| InChIKey | VUPPKOGGGQYLFF-KVVVOXFISA-N |
| XLogP | 3.53 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|