C14H32N4 — CID 153397872
(4Z)-5-[amino(methyl)amino]bicyclo[6.1.0]non-4-en-4-amine;ethane;N-methylmethanamine (PubChem CID 153397872) has the molecular formula C14H32N4 and a molecular weight of 256.44 g/mol. Its IUPAC name is (4Z)-5-[amino(methyl)amino]bicyclo[6.1.0]non-4-en-4-amine;ethane;N-methylmethanamine.
| Compound Name | (4Z)-5-[amino(methyl)amino]bicyclo[6.1.0]non-4-en-4-amine;ethane;N-methylmethanamine |
|---|---|
| PubChem CID | 153397872 |
| Molecular Formula | C14H32N4 |
| Molecular Weight | 256.44 g/mol |
| Exact Mass | 256.26 |
| IUPAC Name | (4Z)-5-[amino(methyl)amino]bicyclo[6.1.0]non-4-en-4-amine;ethane;N-methylmethanamine |
| SMILES | CC.CN(N)/C1=C(\N)CCC2CC2CC1.CNC |
| InChI | InChI=1S/C10H19N3.C2H7N.C2H6/c1-13(12)10-5-3-8-6-7(8)2-4-9(10)11;1-3-2;1-2/h7-8H,2-6,11-12H2,1H3;3H,1-2H3;1-2H3/b10-9-;; |
| InChIKey | TUEMRZVUJXDVPW-XXAVUKJNSA-N |
| XLogP | 2.03 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|