C9H18N4 — CID 155721302
(4Z)-5-N,5-N-diaminobicyclo[6.1.0]non-4-ene-4,5-diamine (PubChem CID 155721302) has the molecular formula C9H18N4 and a molecular weight of 182.27 g/mol. Its IUPAC name is (4Z)-5-N,5-N-diaminobicyclo[6.1.0]non-4-ene-4,5-diamine.
| Compound Name | (4Z)-5-N,5-N-diaminobicyclo[6.1.0]non-4-ene-4,5-diamine |
|---|---|
| PubChem CID | 155721302 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | (4Z)-5-N,5-N-diaminobicyclo[6.1.0]non-4-ene-4,5-diamine |
| SMILES | N/C1=C(\N(N)N)CCC2CC2CC1 |
| InChI | InChI=1S/C9H18N4/c10-8-3-1-6-5-7(6)2-4-9(8)13(11)12/h6-7H,1-5,10-12H2/b9-8- |
| InChIKey | MXIUWVDCPZHZPL-HJWRWDBZSA-N |
| XLogP | 0.42 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|