C12H26N4 — CID 155714672
(4Z)-5-[amino(methyl)amino]bicyclo[6.1.0]non-4-en-4-amine;N-methylmethanamine (PubChem CID 155714672) has the molecular formula C12H26N4 and a molecular weight of 226.37 g/mol. Its IUPAC name is (4Z)-5-[amino(methyl)amino]bicyclo[6.1.0]non-4-en-4-amine;N-methylmethanamine.
| Compound Name | (4Z)-5-[amino(methyl)amino]bicyclo[6.1.0]non-4-en-4-amine;N-methylmethanamine |
|---|---|
| PubChem CID | 155714672 |
| Molecular Formula | C12H26N4 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.22 |
| IUPAC Name | (4Z)-5-[amino(methyl)amino]bicyclo[6.1.0]non-4-en-4-amine;N-methylmethanamine |
| SMILES | CN(N)/C1=C(\N)CCC2CC2CC1.CNC |
| InChI | InChI=1S/C10H19N3.C2H7N/c1-13(12)10-5-3-8-6-7(8)2-4-9(10)11;1-3-2/h7-8H,2-6,11-12H2,1H3;3H,1-2H3/b10-9-; |
| InChIKey | HKYRNRDIYOSHLY-KVVVOXFISA-N |
| XLogP | 1.01 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|