About S-cyano (2S)-2-methylbutanethioate
S-cyano (2S)-2-methylbutanethioate (PubChem CID 126542070) has the molecular formula C6H9NOS
and a molecular weight of 143.21 g/mol. Its IUPAC name is S-cyano (2S)-2-methylbutanethioate.
Molecular Properties
| Compound Name | S-cyano (2S)-2-methylbutanethioate |
| PubChem CID | 126542070 |
| Molecular Formula | C6H9NOS |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.04 |
| IUPAC Name | S-cyano (2S)-2-methylbutanethioate |
| SMILES | CC[C@H](C)C(=O)SC#N |
| InChI | InChI=1S/C6H9NOS/c1-3-5(2)6(8)9-4-7/h5H,3H2,1-2H3/t5-/m0/s1 |
| InChIKey | JSFQZJRQWYGCAT-YFKPBYRVSA-N |
| XLogP | 1.77 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-cyano (2S)-2-methylbutanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-cyano (2S)-2-methylbutanethioate?
The IUPAC name of S-cyano (2S)-2-methylbutanethioate (CID 126542070) is S-cyano (2S)-2-methylbutanethioate.
What is the SMILES notation for S-cyano (2S)-2-methylbutanethioate?
The canonical SMILES for S-cyano (2S)-2-methylbutanethioate is CC[C@H](C)C(=O)SC#N.
What is the InChIKey of S-cyano (2S)-2-methylbutanethioate?
The InChIKey is JSFQZJRQWYGCAT-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H9NOS/c1-3-5(2)6(8)9-4-7/h5H,3H2,1-2H3/t5-/m0/s1.
What are the key properties of S-cyano (2S)-2-methylbutanethioate?
S-cyano (2S)-2-methylbutanethioate has a molecular weight of 143.21 g/mol, XLogP of 1.77, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-cyano (2S)-2-methylbutanethioate is sourced from PubChem (CID 126542070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).