About 4-methyl-2,3-di(propan-2-yl)-1,3-thiazinane
4-methyl-2,3-di(propan-2-yl)-1,3-thiazinane (PubChem CID 126543354) has the molecular formula C11H23NS
and a molecular weight of 201.38 g/mol. Its IUPAC name is 4-methyl-2,3-di(propan-2-yl)-1,3-thiazinane.
Molecular Properties
| Compound Name | 4-methyl-2,3-di(propan-2-yl)-1,3-thiazinane |
| PubChem CID | 126543354 |
| Molecular Formula | C11H23NS |
| Molecular Weight | 201.38 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | 4-methyl-2,3-di(propan-2-yl)-1,3-thiazinane |
| SMILES | CC(C)C1SCCC(C)N1C(C)C |
| InChI | InChI=1S/C11H23NS/c1-8(2)11-12(9(3)4)10(5)6-7-13-11/h8-11H,6-7H2,1-5H3 |
| InChIKey | ZTFKBPGNNYZXPJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-2,3-di(propan-2-yl)-1,3-thiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,3-di(propan-2-yl)-1,3-thiazinane?
The IUPAC name of 4-methyl-2,3-di(propan-2-yl)-1,3-thiazinane (CID 126543354) is 4-methyl-2,3-di(propan-2-yl)-1,3-thiazinane.
What is the SMILES notation for 4-methyl-2,3-di(propan-2-yl)-1,3-thiazinane?
The canonical SMILES for 4-methyl-2,3-di(propan-2-yl)-1,3-thiazinane is CC(C)C1SCCC(C)N1C(C)C.
What is the InChIKey of 4-methyl-2,3-di(propan-2-yl)-1,3-thiazinane?
The InChIKey is ZTFKBPGNNYZXPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NS/c1-8(2)11-12(9(3)4)10(5)6-7-13-11/h8-11H,6-7H2,1-5H3.
What are the key properties of 4-methyl-2,3-di(propan-2-yl)-1,3-thiazinane?
4-methyl-2,3-di(propan-2-yl)-1,3-thiazinane has a molecular weight of 201.38 g/mol, XLogP of 3.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,3-di(propan-2-yl)-1,3-thiazinane is sourced from PubChem (CID 126543354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).