C49H36N4O — CID 126543775
5-[4-[2-(9,9-dimethylfluoren-4-yl)-6-(3-phenylphenyl)-1,4-dihydro-1,3,5-triazin-4-yl]phenyl]phenanthridin-6-one (PubChem CID 126543775) has the molecular formula C49H36N4O and a molecular weight of 696.85 g/mol. Its IUPAC name is 5-[4-[2-(9,9-dimethylfluoren-4-yl)-6-(3-phenylphenyl)-1,4-dihydro-1,3,5-triazin-4-yl]phenyl]phenanthridin-6-one.
| Compound Name | 5-[4-[2-(9,9-dimethylfluoren-4-yl)-6-(3-phenylphenyl)-1,4-dihydro-1,3,5-triazin-4-yl]phenyl]phenanthridin-6-one |
|---|---|
| PubChem CID | 126543775 |
| Molecular Formula | C49H36N4O |
| Molecular Weight | 696.85 g/mol |
| Exact Mass | 696.29 |
| IUPAC Name | 5-[4-[2-(9,9-dimethylfluoren-4-yl)-6-(3-phenylphenyl)-1,4-dihydro-1,3,5-triazin-4-yl]phenyl]phenanthridin-6-one |
| SMILES | CC1(C)c2ccccc2-c2c(C3=NC(c4ccc(-n5c(=O)c6ccccc6c6ccccc65)cc4)N=C(c4cccc(-c5ccccc5)c4)N3)cccc21 |
| InChI | InChI=1S/C49H36N4O/c1-49(2)41-23-10-8-21-39(41)44-40(22-13-24-42(44)49)47-51-45(50-46(52-47)34-17-12-16-33(30-34)31-14-4-3-5-15-31)32-26-28-35(29-27-32)53-43-25-11-9-19-37(43)36-18-6-7-20-38(36)48(53)54/h3-30,45H,1-2H3,(H,50,51,52) |
| InChIKey | SECDSWOBCTZCTR-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 58.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.85 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|