About 1-chloro-4-(2,2,3,4,4-pentamethylpentan-3-yl)benzene
1-chloro-4-(2,2,3,4,4-pentamethylpentan-3-yl)benzene (PubChem CID 126544009) has the molecular formula C16H25Cl
and a molecular weight of 252.83 g/mol. Its IUPAC name is 1-chloro-4-(2,2,3,4,4-pentamethylpentan-3-yl)benzene.
Analyze 1-chloro-4-(2,2,3,4,4-pentamethylpentan-3-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-(2,2,3,4,4-pentamethylpentan-3-yl)benzene?
The IUPAC name of 1-chloro-4-(2,2,3,4,4-pentamethylpentan-3-yl)benzene (CID 126544009) is 1-chloro-4-(2,2,3,4,4-pentamethylpentan-3-yl)benzene.
What is the SMILES notation for 1-chloro-4-(2,2,3,4,4-pentamethylpentan-3-yl)benzene?
The canonical SMILES for 1-chloro-4-(2,2,3,4,4-pentamethylpentan-3-yl)benzene is CC(C)(C)C(C)(c1ccc(Cl)cc1)C(C)(C)C.
What is the InChIKey of 1-chloro-4-(2,2,3,4,4-pentamethylpentan-3-yl)benzene?
The InChIKey is NPBQCSXELDWBRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25Cl/c1-14(2,3)16(7,15(4,5)6)12-8-10-13(17)11-9-12/h8-11H,1-7H3.
What are the key properties of 1-chloro-4-(2,2,3,4,4-pentamethylpentan-3-yl)benzene?
1-chloro-4-(2,2,3,4,4-pentamethylpentan-3-yl)benzene has a molecular weight of 252.83 g/mol, XLogP of 5.69, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-(2,2,3,4,4-pentamethylpentan-3-yl)benzene is sourced from PubChem (CID 126544009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).