C9H12O — CID 126544021
(3E,5Z)-4-(methoxymethyl)hepta-3,5-dien-1-yne (PubChem CID 126544021) has the molecular formula C9H12O and a molecular weight of 136.19 g/mol. Its IUPAC name is (3E,5Z)-4-(methoxymethyl)hepta-3,5-dien-1-yne.
| Compound Name | (3E,5Z)-4-(methoxymethyl)hepta-3,5-dien-1-yne |
|---|---|
| PubChem CID | 126544021 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | (3E,5Z)-4-(methoxymethyl)hepta-3,5-dien-1-yne |
| SMILES | C#C/C=C(\C=C/C)COC |
| InChI | InChI=1S/C9H12O/c1-4-6-9(7-5-2)8-10-3/h1,5-7H,8H2,2-3H3/b7-5-,9-6+ |
| InChIKey | DVICEUFSWNLKNK-XCZNYUDNSA-N |
| XLogP | 1.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|