C9H9F3O — CID 142273583
(3Z,5Z)-4-methyl-7-(trifluoromethoxy)hepta-3,5-dien-1-yne (PubChem CID 142273583) has the molecular formula C9H9F3O and a molecular weight of 190.16 g/mol. Its IUPAC name is (3Z,5Z)-4-methyl-7-(trifluoromethoxy)hepta-3,5-dien-1-yne.
| Compound Name | (3Z,5Z)-4-methyl-7-(trifluoromethoxy)hepta-3,5-dien-1-yne |
|---|---|
| PubChem CID | 142273583 |
| Molecular Formula | C9H9F3O |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | (3Z,5Z)-4-methyl-7-(trifluoromethoxy)hepta-3,5-dien-1-yne |
| SMILES | C#C/C=C(C)\C=C/COC(F)(F)F |
| InChI | InChI=1S/C9H9F3O/c1-3-5-8(2)6-4-7-13-9(10,11)12/h1,4-6H,7H2,2H3/b6-4-,8-5- |
| InChIKey | PAMJUZCMKLZYQX-VXWIUBPCSA-N |
| XLogP | 2.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|