C21H33N3O — CID 126544205
(NE)-N-[1-[(3S,10R,13S)-3-hydrazinyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylidene]hydroxylamine (PubChem CID 126544205) has the molecular formula C21H33N3O and a molecular weight of 343.52 g/mol. Its IUPAC name is (NE)-N-[1-[(3S,10R,13S)-3-hydrazinyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-[(3S,10R,13S)-3-hydrazinyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 126544205 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | (NE)-N-[1-[(3S,10R,13S)-3-hydrazinyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylidene]hydroxylamine |
| SMILES | C/C(=N\O)C1=CCC2C3CC=C4C[C@@H](NN)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C21H33N3O/c1-13(24-25)17-6-7-18-16-5-4-14-12-15(23-22)8-10-20(14,2)19(16)9-11-21(17,18)3/h4,6,15-16,18-19,23,25H,5,7-12,22H2,1-3H3/b24-13+/t15-,16?,18?,19?,20-,21+/m0/s1 |
| InChIKey | PHCZKYFIVXFQCE-KXALKRHPSA-N |
| XLogP | 4.17 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|