C21H31NO3 — CID 11886933
(1R,3R,8R,9R,10R,13R,14R)-17-[(E)-N-hydroxy-C-methylcarbonimidoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-1,3-diol (PubChem CID 11886933) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is (1R,3R,8R,9R,10R,13R,14R)-17-[(E)-N-hydroxy-C-methylcarbonimidoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-1,3-diol.
| Compound Name | (1R,3R,8R,9R,10R,13R,14R)-17-[(E)-N-hydroxy-C-methylcarbonimidoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-1,3-diol |
|---|---|
| PubChem CID | 11886933 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | (1R,3R,8R,9R,10R,13R,14R)-17-[(E)-N-hydroxy-C-methylcarbonimidoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-1,3-diol |
| SMILES | C/C(=N\O)C1=CC[C@@H]2[C@H]3CC=C4C[C@@H](O)C[C@@H](O)[C@]4(C)[C@@H]3CC[C@@]12C |
| InChI | InChI=1S/C21H31NO3/c1-12(22-25)16-6-7-17-15-5-4-13-10-14(23)11-19(24)21(13,3)18(15)8-9-20(16,17)2/h4,6,14-15,17-19,23-25H,5,7-11H2,1-3H3/b22-12+/t14-,15-,17-,18-,19-,20+,21+/m1/s1 |
| InChIKey | XETDBTMQGVJJOY-PXJMXDSTSA-N |
| XLogP | 3.67 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|