C22H34O3 — CID 70476265
(8S,9S,10R,13S,14S)-17-[(2S)-1-hydroxypropan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-1,3-diol (PubChem CID 70476265) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S)-17-[(2S)-1-hydroxypropan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-1,3-diol.
| Compound Name | (8S,9S,10R,13S,14S)-17-[(2S)-1-hydroxypropan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-1,3-diol |
|---|---|
| PubChem CID | 70476265 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | (8S,9S,10R,13S,14S)-17-[(2S)-1-hydroxypropan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-1,3-diol |
| SMILES | C[C@H](CO)C1=CC[C@H]2[C@@H]3CC=C4CC(O)CC(O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H34O3/c1-13(12-23)17-6-7-18-16-5-4-14-10-15(24)11-20(25)22(14,3)19(16)8-9-21(17,18)2/h4,6,13,15-16,18-20,23-25H,5,7-12H2,1-3H3/t13-,15?,16+,18+,19+,20?,21-,22+/m1/s1 |
| InChIKey | UNWRDWRRFZTDDM-MTPYTHHBSA-N |
| XLogP | 3.45 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|