C31H38N4O3 — CID 126544920
1'-[[4-(4-hydroxybutyl)isoquinolin-3-yl]methyl]-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]spiro[piperidine-4,3'-pyrrolo[2,3-c]pyridine]-2'-one (PubChem CID 126544920) has the molecular formula C31H38N4O3 and a molecular weight of 514.67 g/mol. Its IUPAC name is 1'-[[4-(4-hydroxybutyl)isoquinolin-3-yl]methyl]-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]spiro[piperidine-4,3'-pyrrolo[2,3-c]pyridine]-2'-one.
| Compound Name | 1'-[[4-(4-hydroxybutyl)isoquinolin-3-yl]methyl]-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]spiro[piperidine-4,3'-pyrrolo[2,3-c]pyridine]-2'-one |
|---|---|
| PubChem CID | 126544920 |
| Molecular Formula | C31H38N4O3 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | 1'-[[4-(4-hydroxybutyl)isoquinolin-3-yl]methyl]-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]spiro[piperidine-4,3'-pyrrolo[2,3-c]pyridine]-2'-one |
| SMILES | C=C(OC(C)(C)C)N1CCC2(CC1)C(=O)N(Cc1ncc3ccccc3c1CCCCO)c1cnccc12 |
| InChI | InChI=1S/C31H38N4O3/c1-22(38-30(2,3)4)34-16-13-31(14-17-34)26-12-15-32-20-28(26)35(29(31)37)21-27-25(11-7-8-18-36)24-10-6-5-9-23(24)19-33-27/h5-6,9-10,12,15,19-20,36H,1,7-8,11,13-14,16-18,21H2,2-4H3 |
| InChIKey | WZHVIGWPQIUBRW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|