C16H12F3N3O2 — CID 126545799
N-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-fluorophenyl]methyl]-N-phenylhydroxylamine (PubChem CID 126545799) has the molecular formula C16H12F3N3O2 and a molecular weight of 335.29 g/mol. Its IUPAC name is N-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-fluorophenyl]methyl]-N-phenylhydroxylamine.
| Compound Name | N-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-fluorophenyl]methyl]-N-phenylhydroxylamine |
|---|---|
| PubChem CID | 126545799 |
| Molecular Formula | C16H12F3N3O2 |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | N-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-fluorophenyl]methyl]-N-phenylhydroxylamine |
| SMILES | ON(Cc1ccc(-c2nnc(C(F)F)o2)cc1F)c1ccccc1 |
| InChI | InChI=1S/C16H12F3N3O2/c17-13-8-10(15-20-21-16(24-15)14(18)19)6-7-11(13)9-22(23)12-4-2-1-3-5-12/h1-8,14,23H,9H2 |
| InChIKey | KNWHNBKYWNOXTL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|