C19H16ClF3N4O2 — CID 140894641
3-(2-chloroethyl)-1-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-fluorophenyl]methyl]-1-phenylurea (PubChem CID 140894641) has the molecular formula C19H16ClF3N4O2 and a molecular weight of 424.81 g/mol. Its IUPAC name is 3-(2-chloroethyl)-1-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-fluorophenyl]methyl]-1-phenylurea.
| Compound Name | 3-(2-chloroethyl)-1-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-fluorophenyl]methyl]-1-phenylurea |
|---|---|
| PubChem CID | 140894641 |
| Molecular Formula | C19H16ClF3N4O2 |
| Molecular Weight | 424.81 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 3-(2-chloroethyl)-1-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-fluorophenyl]methyl]-1-phenylurea |
| SMILES | O=C(NCCCl)N(Cc1ccc(-c2nnc(C(F)F)o2)cc1F)c1ccccc1 |
| InChI | InChI=1S/C19H16ClF3N4O2/c20-8-9-24-19(28)27(14-4-2-1-3-5-14)11-13-7-6-12(10-15(13)21)17-25-26-18(29-17)16(22)23/h1-7,10,16H,8-9,11H2,(H,24,28) |
| InChIKey | CSMYUQLJHRRBEO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.81 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|