C13H17N3O2 — CID 12654611
[(E)-(3,3-dimethyl-4-oxo-4-phenylbutan-2-ylidene)amino]urea (PubChem CID 12654611) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is [(E)-(3,3-dimethyl-4-oxo-4-phenylbutan-2-ylidene)amino]urea.
| Compound Name | [(E)-(3,3-dimethyl-4-oxo-4-phenylbutan-2-ylidene)amino]urea |
|---|---|
| PubChem CID | 12654611 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | [(E)-(3,3-dimethyl-4-oxo-4-phenylbutan-2-ylidene)amino]urea |
| SMILES | C/C(=N\NC(N)=O)C(C)(C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C13H17N3O2/c1-9(15-16-12(14)18)13(2,3)11(17)10-7-5-4-6-8-10/h4-8H,1-3H3,(H3,14,16,18)/b15-9+ |
| InChIKey | HMCSBZAYYHAVEQ-OQLLNIDSSA-N |
| XLogP | 1.94 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|