C17H33N7O — CID 126547396
6-amino-2-[4-[(1S,2S)-1-amino-2-methylbutyl]triazol-1-yl]-1-piperazin-1-ylhexan-1-one (PubChem CID 126547396) has the molecular formula C17H33N7O and a molecular weight of 351.50 g/mol. Its IUPAC name is 6-amino-2-[4-[(1S,2S)-1-amino-2-methylbutyl]triazol-1-yl]-1-piperazin-1-ylhexan-1-one.
| Compound Name | 6-amino-2-[4-[(1S,2S)-1-amino-2-methylbutyl]triazol-1-yl]-1-piperazin-1-ylhexan-1-one |
|---|---|
| PubChem CID | 126547396 |
| Molecular Formula | C17H33N7O |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.27 |
| IUPAC Name | 6-amino-2-[4-[(1S,2S)-1-amino-2-methylbutyl]triazol-1-yl]-1-piperazin-1-ylhexan-1-one |
| SMILES | CC[C@H](C)[C@H](N)c1cn(C(CCCCN)C(=O)N2CCNCC2)nn1 |
| InChI | InChI=1S/C17H33N7O/c1-3-13(2)16(19)14-12-24(22-21-14)15(6-4-5-7-18)17(25)23-10-8-20-9-11-23/h12-13,15-16,20H,3-11,18-19H2,1-2H3/t13-,15?,16-/m0/s1 |
| InChIKey | OXVNZDVIEJEMHM-VFDRBLODSA-N |
| XLogP | 0.43 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|