C14H26N6O2 — CID 126547383
(3S)-2-[4-(4-aminobutyl)triazol-1-yl]-3-hydroxy-1-piperazin-1-ylbutan-1-one (PubChem CID 126547383) has the molecular formula C14H26N6O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (3S)-2-[4-(4-aminobutyl)triazol-1-yl]-3-hydroxy-1-piperazin-1-ylbutan-1-one.
| Compound Name | (3S)-2-[4-(4-aminobutyl)triazol-1-yl]-3-hydroxy-1-piperazin-1-ylbutan-1-one |
|---|---|
| PubChem CID | 126547383 |
| Molecular Formula | C14H26N6O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | (3S)-2-[4-(4-aminobutyl)triazol-1-yl]-3-hydroxy-1-piperazin-1-ylbutan-1-one |
| SMILES | C[C@H](O)C(C(=O)N1CCNCC1)n1cc(CCCCN)nn1 |
| InChI | InChI=1S/C14H26N6O2/c1-11(21)13(14(22)19-8-6-16-7-9-19)20-10-12(17-18-20)4-2-3-5-15/h10-11,13,16,21H,2-9,15H2,1H3/t11-,13?/m0/s1 |
| InChIKey | JOXSFRTWDJVKNF-AMGKYWFPSA-N |
| XLogP | -1.09 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|