C25H30N2O4 — CID 126547415
4-cyclooctyl-N-[4-(4-nitrophenyl)phenyl]oxolane-2-carboxamide (PubChem CID 126547415) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 4-cyclooctyl-N-[4-(4-nitrophenyl)phenyl]oxolane-2-carboxamide.
| Compound Name | 4-cyclooctyl-N-[4-(4-nitrophenyl)phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 126547415 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 4-cyclooctyl-N-[4-(4-nitrophenyl)phenyl]oxolane-2-carboxamide |
| SMILES | O=C(Nc1ccc(-c2ccc([N+](=O)[O-])cc2)cc1)C1CC(C2CCCCCCC2)CO1 |
| InChI | InChI=1S/C25H30N2O4/c28-25(24-16-21(17-31-24)18-6-4-2-1-3-5-7-18)26-22-12-8-19(9-13-22)20-10-14-23(15-11-20)27(29)30/h8-15,18,21,24H,1-7,16-17H2,(H,26,28) |
| InChIKey | ZHBLQUWZLWHPSA-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|