C16H18N2O4 — CID 50938320
(1S,5S)-N-(4-nitrophenyl)-9-oxobicyclo[3.3.1]nonane-3-carboxamide (PubChem CID 50938320) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is (1S,5S)-N-(4-nitrophenyl)-9-oxobicyclo[3.3.1]nonane-3-carboxamide.
| Compound Name | (1S,5S)-N-(4-nitrophenyl)-9-oxobicyclo[3.3.1]nonane-3-carboxamide |
|---|---|
| PubChem CID | 50938320 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (1S,5S)-N-(4-nitrophenyl)-9-oxobicyclo[3.3.1]nonane-3-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)C1C[C@@H]2CCC[C@@H](C1)C2=O |
| InChI | InChI=1S/C16H18N2O4/c19-15-10-2-1-3-11(15)9-12(8-10)16(20)17-13-4-6-14(7-5-13)18(21)22/h4-7,10-12H,1-3,8-9H2,(H,17,20)/t10-,11-/m0/s1 |
| InChIKey | QGFXNALCBONDTN-QWRGUYRKSA-N |
| XLogP | 2.93 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|