C14H11ClFN3O3 — CID 126549718
4-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-2,6-dimethyl-1,2,4-triazine-3,5-dione (PubChem CID 126549718) has the molecular formula C14H11ClFN3O3 and a molecular weight of 323.71 g/mol. Its IUPAC name is 4-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-2,6-dimethyl-1,2,4-triazine-3,5-dione.
| Compound Name | 4-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-2,6-dimethyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 126549718 |
| Molecular Formula | C14H11ClFN3O3 |
| Molecular Weight | 323.71 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 4-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-2,6-dimethyl-1,2,4-triazine-3,5-dione |
| SMILES | C#CCOc1cc(-n2c(=O)c(C)nn(C)c2=O)c(F)cc1Cl |
| InChI | InChI=1S/C14H11ClFN3O3/c1-4-5-22-12-7-11(10(16)6-9(12)15)19-13(20)8(2)17-18(3)14(19)21/h1,6-7H,5H2,2-3H3 |
| InChIKey | HWGDBBIPRGQGFN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.71 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|