C13H13ClFN3O2S — CID 4187695
2-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)-4-methyl-5-sulfanylidene-1,2,4-triazin-3-one (PubChem CID 4187695) has the molecular formula C13H13ClFN3O2S and a molecular weight of 329.78 g/mol. Its IUPAC name is 2-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)-4-methyl-5-sulfanylidene-1,2,4-triazin-3-one.
| Compound Name | 2-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)-4-methyl-5-sulfanylidene-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 4187695 |
| Molecular Formula | C13H13ClFN3O2S |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 2-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)-4-methyl-5-sulfanylidene-1,2,4-triazin-3-one |
| SMILES | CC(C)Oc1cc(-n2ncc(=S)n(C)c2=O)c(F)cc1Cl |
| InChI | InChI=1S/C13H13ClFN3O2S/c1-7(2)20-11-5-10(9(15)4-8(11)14)18-13(19)17(3)12(21)6-16-18/h4-7H,1-3H3 |
| InChIKey | GUNVJHMULJWPLV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|