C24H39N6O3S+ — CID 126552964
3-(2-carbamoylanilino)propyl-dimethyl-[3-[4-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)butanoylamino]propyl]azanium (PubChem CID 126552964) has the molecular formula C24H39N6O3S+ and a molecular weight of 491.68 g/mol. Its IUPAC name is 3-(2-carbamoylanilino)propyl-dimethyl-[3-[4-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)butanoylamino]propyl]azanium.
| Compound Name | 3-(2-carbamoylanilino)propyl-dimethyl-[3-[4-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)butanoylamino]propyl]azanium |
|---|---|
| PubChem CID | 126552964 |
| Molecular Formula | C24H39N6O3S+ |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | 3-(2-carbamoylanilino)propyl-dimethyl-[3-[4-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)butanoylamino]propyl]azanium |
| SMILES | C[N+](C)(CCCNC(=O)CCCC1SCC2NC(=O)NC21)CCCNc1ccccc1C(N)=O |
| InChI | InChI=1S/C24H38N6O3S/c1-30(2,14-6-12-26-18-9-4-3-8-17(18)23(25)32)15-7-13-27-21(31)11-5-10-20-22-19(16-34-20)28-24(33)29-22/h3-4,8-9,19-20,22H,5-7,10-16H2,1-2H3,(H5-,25,26,27,28,29,31,32,33)/p+1 |
| InChIKey | OYAIDTYEBHRYDJ-UHFFFAOYSA-O |
| XLogP | 1.51 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|