C21H22FN3O8 — CID 126553862
[(2R,3S,4R,5R)-3,4-diacetyloxy-5-(4-amino-2-oxopyrimidin-1-yl)-2-fluoro-4-methyloxolan-2-yl]methyl benzoate (PubChem CID 126553862) has the molecular formula C21H22FN3O8 and a molecular weight of 463.42 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-diacetyloxy-5-(4-amino-2-oxopyrimidin-1-yl)-2-fluoro-4-methyloxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4R,5R)-3,4-diacetyloxy-5-(4-amino-2-oxopyrimidin-1-yl)-2-fluoro-4-methyloxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 126553862 |
| Molecular Formula | C21H22FN3O8 |
| Molecular Weight | 463.42 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-diacetyloxy-5-(4-amino-2-oxopyrimidin-1-yl)-2-fluoro-4-methyloxolan-2-yl]methyl benzoate |
| SMILES | CC(=O)O[C@H]1[C@@](C)(OC(C)=O)[C@H](n2ccc(N)nc2=O)O[C@@]1(F)COC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H22FN3O8/c1-12(26)31-17-20(3,32-13(2)27)18(25-10-9-15(23)24-19(25)29)33-21(17,22)11-30-16(28)14-7-5-4-6-8-14/h4-10,17-18H,11H2,1-3H3,(H2,23,24,29)/t17-,18+,20+,21-/m0/s1 |
| InChIKey | KPPUYSJDGJULBP-ZSXPUABSSA-N |
| XLogP | 1.13 |
| TPSA | 149.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.42 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|