About 4-ethoxychromenylium
4-ethoxychromenylium (PubChem CID 12655463) has the molecular formula C11H11O2+
and a molecular weight of 175.21 g/mol. Its IUPAC name is 4-ethoxychromenylium.
Molecular Properties
| Compound Name | 4-ethoxychromenylium |
| PubChem CID | 12655463 |
| Molecular Formula | C11H11O2+ |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 4-ethoxychromenylium |
| SMILES | CCOc1cc[o+]c2ccccc12 |
| InChI | InChI=1S/C11H11O2/c1-2-12-11-7-8-13-10-6-4-3-5-9(10)11/h3-8H,2H2,1H3/q+1 |
| InChIKey | SJWDIHZHJZZYKQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxychromenylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxychromenylium?
The IUPAC name of 4-ethoxychromenylium (CID 12655463) is 4-ethoxychromenylium.
What is the SMILES notation for 4-ethoxychromenylium?
The canonical SMILES for 4-ethoxychromenylium is CCOc1cc[o+]c2ccccc12.
What is the InChIKey of 4-ethoxychromenylium?
The InChIKey is SJWDIHZHJZZYKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11O2/c1-2-12-11-7-8-13-10-6-4-3-5-9(10)11/h3-8H,2H2,1H3/q+1.
What are the key properties of 4-ethoxychromenylium?
4-ethoxychromenylium has a molecular weight of 175.21 g/mol, XLogP of 3.11, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxychromenylium is sourced from PubChem (CID 12655463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).