C27H25ClN2O4 — CID 126555115
trans-benzyl (1R,2R)-2-[(2-chloro-4-pyridinyl)methyl]-3-oxo-4-[[(1R)-1-phenylethyl]carbamoyl]cyclobutane-1-carboxylate (PubChem CID 126555115) has the molecular formula C27H25ClN2O4 and a molecular weight of 476.96 g/mol. Its IUPAC name is trans-benzyl (1R,2R)-2-[(2-chloro-4-pyridinyl)methyl]-3-oxo-4-[[(1R)-1-phenylethyl]carbamoyl]cyclobutane-1-carboxylate.
| Compound Name | trans-benzyl (1R,2R)-2-[(2-chloro-4-pyridinyl)methyl]-3-oxo-4-[[(1R)-1-phenylethyl]carbamoyl]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 126555115 |
| Molecular Formula | C27H25ClN2O4 |
| Molecular Weight | 476.96 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | trans-benzyl (1R,2R)-2-[(2-chloro-4-pyridinyl)methyl]-3-oxo-4-[[(1R)-1-phenylethyl]carbamoyl]cyclobutane-1-carboxylate |
| SMILES | C[C@@H](NC(=O)C1C(=O)[C@H](Cc2ccnc(Cl)c2)[C@H]1C(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H25ClN2O4/c1-17(20-10-6-3-7-11-20)30-26(32)24-23(27(33)34-16-18-8-4-2-5-9-18)21(25(24)31)14-19-12-13-29-22(28)15-19/h2-13,15,17,21,23-24H,14,16H2,1H3,(H,30,32)/t17-,21-,23-,24?/m1/s1 |
| InChIKey | NEXFWFPCQGJMNT-BZAGWVOSSA-N |
| XLogP | 4.33 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.96 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|