C18H29N7O — CID 126556737
3-[1-[3-(azepan-1-yl)propyl]pyrazolo[3,4-d]pyrimidin-4-yl]propylurea (PubChem CID 126556737) has the molecular formula C18H29N7O and a molecular weight of 359.48 g/mol. Its IUPAC name is 3-[1-[3-(azepan-1-yl)propyl]pyrazolo[3,4-d]pyrimidin-4-yl]propylurea.
| Compound Name | 3-[1-[3-(azepan-1-yl)propyl]pyrazolo[3,4-d]pyrimidin-4-yl]propylurea |
|---|---|
| PubChem CID | 126556737 |
| Molecular Formula | C18H29N7O |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | 3-[1-[3-(azepan-1-yl)propyl]pyrazolo[3,4-d]pyrimidin-4-yl]propylurea |
| SMILES | NC(=O)NCCCc1ncnc2c1cnn2CCCN1CCCCCC1 |
| InChI | InChI=1S/C18H29N7O/c19-18(26)20-8-5-7-16-15-13-23-25(17(15)22-14-21-16)12-6-11-24-9-3-1-2-4-10-24/h13-14H,1-12H2,(H3,19,20,26) |
| InChIKey | WBBXYTXNENMASF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|