C19H38NP — CID 126559508
4,4,7,8,9-pentamethyl-N-(3-phosphanylbut-3-enyl)dec-1-en-2-amine (PubChem CID 126559508) has the molecular formula C19H38NP and a molecular weight of 311.49 g/mol. Its IUPAC name is 4,4,7,8,9-pentamethyl-N-(3-phosphanylbut-3-enyl)dec-1-en-2-amine.
| Compound Name | 4,4,7,8,9-pentamethyl-N-(3-phosphanylbut-3-enyl)dec-1-en-2-amine |
|---|---|
| PubChem CID | 126559508 |
| Molecular Formula | C19H38NP |
| Molecular Weight | 311.49 g/mol |
| Exact Mass | 311.27 |
| IUPAC Name | 4,4,7,8,9-pentamethyl-N-(3-phosphanylbut-3-enyl)dec-1-en-2-amine |
| SMILES | C=C(P)CCNC(=C)CC(C)(C)CCC(C)C(C)C(C)C |
| InChI | InChI=1S/C19H38NP/c1-14(2)18(6)15(3)9-11-19(7,8)13-16(4)20-12-10-17(5)21/h14-15,18,20H,4-5,9-13,21H2,1-3,6-8H3 |
| InChIKey | QVNXHMBNCZKOMR-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.49 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|