About N-heptan-4-yl-4,8-dimethylnona-1,8-dien-2-amine
N-heptan-4-yl-4,8-dimethylnona-1,8-dien-2-amine (PubChem CID 126510679) has the molecular formula C18H35N
and a molecular weight of 265.48 g/mol. Its IUPAC name is N-heptan-4-yl-4,8-dimethylnona-1,8-dien-2-amine.
Molecular Properties
| Compound Name | N-heptan-4-yl-4,8-dimethylnona-1,8-dien-2-amine |
| PubChem CID | 126510679 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.48 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | N-heptan-4-yl-4,8-dimethylnona-1,8-dien-2-amine |
| SMILES | C=C(C)CCCC(C)CC(=C)NC(CCC)CCC |
| InChI | InChI=1S/C18H35N/c1-7-10-18(11-8-2)19-17(6)14-16(5)13-9-12-15(3)4/h16,18-19H,3,6-14H2,1-2,4-5H3 |
| InChIKey | KLCPHDYBQRMFRJ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 265.48 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-heptan-4-yl-4,8-dimethylnona-1,8-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-heptan-4-yl-4,8-dimethylnona-1,8-dien-2-amine?
The IUPAC name of N-heptan-4-yl-4,8-dimethylnona-1,8-dien-2-amine (CID 126510679) is N-heptan-4-yl-4,8-dimethylnona-1,8-dien-2-amine.
What is the SMILES notation for N-heptan-4-yl-4,8-dimethylnona-1,8-dien-2-amine?
The canonical SMILES for N-heptan-4-yl-4,8-dimethylnona-1,8-dien-2-amine is C=C(C)CCCC(C)CC(=C)NC(CCC)CCC.
What is the InChIKey of N-heptan-4-yl-4,8-dimethylnona-1,8-dien-2-amine?
The InChIKey is KLCPHDYBQRMFRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35N/c1-7-10-18(11-8-2)19-17(6)14-16(5)13-9-12-15(3)4/h16,18-19H,3,6-14H2,1-2,4-5H3.
What are the key properties of N-heptan-4-yl-4,8-dimethylnona-1,8-dien-2-amine?
N-heptan-4-yl-4,8-dimethylnona-1,8-dien-2-amine has a molecular weight of 265.48 g/mol, XLogP of 5.83, 12 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-heptan-4-yl-4,8-dimethylnona-1,8-dien-2-amine is sourced from PubChem (CID 126510679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).