C18H35N — CID 126510679
N-heptan-4-yl-4,8-dimethylnona-1,8-dien-2-amine (PubChem CID 126510679) has the molecular formula C18H35N and a molecular weight of 265.48 g/mol. Its IUPAC name is N-heptan-4-yl-4,8-dimethylnona-1,8-dien-2-amine.
| Compound Name | N-heptan-4-yl-4,8-dimethylnona-1,8-dien-2-amine |
|---|---|
| PubChem CID | 126510679 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.48 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | N-heptan-4-yl-4,8-dimethylnona-1,8-dien-2-amine |
| SMILES | C=C(C)CCCC(C)CC(=C)NC(CCC)CCC |
| InChI | InChI=1S/C18H35N/c1-7-10-18(11-8-2)19-17(6)14-16(5)13-9-12-15(3)4/h16,18-19H,3,6-14H2,1-2,4-5H3 |
| InChIKey | KLCPHDYBQRMFRJ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.48 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|